C21H40O2 — CID 175247701
(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3R)-3-methylpentyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene;formic acid (PubChem CID 175247701) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is (1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3R)-3-methylpentyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene;formic acid.
| Compound Name | (1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3R)-3-methylpentyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene;formic acid |
|---|---|
| PubChem CID | 175247701 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | (1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3R)-3-methylpentyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene;formic acid |
| SMILES | CC[C@@H](C)CC[C@H]1[C@@H](C)CC[C@H]2C(C)(C)CCC[C@]12C.O=CO |
| InChI | InChI=1S/C20H38.CH2O2/c1-7-15(2)9-11-17-16(3)10-12-18-19(4,5)13-8-14-20(17,18)6;2-1-3/h15-18H,7-14H2,1-6H3;1H,(H,2,3)/t15-,16+,17+,18+,20-;/m1./s1 |
| InChIKey | RPUIFQJYEXIFKI-NFUWEGAASA-N |
| XLogP | 6.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|