C20H40 — CID 71374334
2-(3,7-dimethylnonyl)-1,1,3-trimethylcyclohexane (PubChem CID 71374334) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is 2-(3,7-dimethylnonyl)-1,1,3-trimethylcyclohexane.
| Compound Name | 2-(3,7-dimethylnonyl)-1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 71374334 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | 2-(3,7-dimethylnonyl)-1,1,3-trimethylcyclohexane |
| SMILES | CCC(C)CCCC(C)CCC1C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H40/c1-7-16(2)10-8-11-17(3)13-14-19-18(4)12-9-15-20(19,5)6/h16-19H,7-15H2,1-6H3 |
| InChIKey | OLXCDJBKPIBKKS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |