C34H64N2O6 — CID 139473592
3,7-dimethyl-N-[3-[2-[2-[3-(4-oxobutanoylamino)propoxy]ethoxy]ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide (PubChem CID 139473592) has the molecular formula C34H64N2O6 and a molecular weight of 596.89 g/mol. Its IUPAC name is 3,7-dimethyl-N-[3-[2-[2-[3-(4-oxobutanoylamino)propoxy]ethoxy]ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide.
| Compound Name | 3,7-dimethyl-N-[3-[2-[2-[3-(4-oxobutanoylamino)propoxy]ethoxy]ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide |
|---|---|
| PubChem CID | 139473592 |
| Molecular Formula | C34H64N2O6 |
| Molecular Weight | 596.89 g/mol |
| Exact Mass | 596.48 |
| IUPAC Name | 3,7-dimethyl-N-[3-[2-[2-[3-(4-oxobutanoylamino)propoxy]ethoxy]ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide |
| SMILES | CC(CCCC(C)CC(=O)NCCCOCCOCCOCCCNC(=O)CCC=O)CCC1C(C)CCCC1(C)C |
| InChI | InChI=1S/C34H64N2O6/c1-28(15-16-31-30(3)13-7-17-34(31,4)5)11-6-12-29(2)27-33(39)36-19-10-22-41-24-26-42-25-23-40-21-9-18-35-32(38)14-8-20-37/h20,28-31H,6-19,21-27H2,1-5H3,(H,35,38)(H,36,39) |
| InChIKey | QYPPYJFUSYREPB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.89 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|