C28H50O — CID 91752443
(6S)-8-[(1R,2S,4bR,10aR)-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-1-yl]-6-methyloctan-2-one (PubChem CID 91752443) has the molecular formula C28H50O and a molecular weight of 402.71 g/mol. Its IUPAC name is (6S)-8-[(1R,2S,4bR,10aR)-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-1-yl]-6-methyloctan-2-one.
| Compound Name | (6S)-8-[(1R,2S,4bR,10aR)-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-1-yl]-6-methyloctan-2-one |
|---|---|
| PubChem CID | 91752443 |
| Molecular Formula | C28H50O |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.39 |
| IUPAC Name | (6S)-8-[(1R,2S,4bR,10aR)-2,4b,8,8,10a-pentamethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthren-1-yl]-6-methyloctan-2-one |
| SMILES | CC(=O)CCC[C@H](C)CC[C@@H]1[C@@H](C)CCC2[C@]3(C)CCCC(C)(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H50O/c1-20(10-8-11-22(3)29)12-14-23-21(2)13-15-25-27(23,6)19-16-24-26(4,5)17-9-18-28(24,25)7/h20-21,23-25H,8-19H2,1-7H3/t20-,21-,23+,24?,25?,27+,28+/m0/s1 |
| InChIKey | DJTIKPPBMWKDMJ-DSFDTLSOSA-N |
| XLogP | 8.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |