C35H60O — CID 162986264
7-(5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl)octan-2-one (PubChem CID 162986264) has the molecular formula C35H60O and a molecular weight of 496.86 g/mol. Its IUPAC name is 7-(5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl)octan-2-one.
| Compound Name | 7-(5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl)octan-2-one |
|---|---|
| PubChem CID | 162986264 |
| Molecular Formula | C35H60O |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.46 |
| IUPAC Name | 7-(5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl)octan-2-one |
| SMILES | CC(=O)CCCCC(C)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3CCC21C |
| InChI | InChI=1S/C35H60O/c1-24(12-9-10-13-25(2)36)26-16-21-32(5)27(26)17-22-34(7)29(32)14-15-30-33(6)20-11-19-31(3,4)28(33)18-23-35(30,34)8/h24,26-30H,9-23H2,1-8H3 |
| InChIKey | ARBKCLDBZGYTGN-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|