C35H60O2 — CID 162980794
[(4R)-4-[(3R,3aS,5aR,5bR,7aS,9R,11aS,11bR,13aR,13bS)-5a,5b,8,8,9,11a,13b-heptamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentyl] acetate (PubChem CID 162980794) has the molecular formula C35H60O2 and a molecular weight of 512.86 g/mol. Its IUPAC name is [(4R)-4-[(3R,3aS,5aR,5bR,7aS,9R,11aS,11bR,13aR,13bS)-5a,5b,8,8,9,11a,13b-heptamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentyl] acetate.
| Compound Name | [(4R)-4-[(3R,3aS,5aR,5bR,7aS,9R,11aS,11bR,13aR,13bS)-5a,5b,8,8,9,11a,13b-heptamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentyl] acetate |
|---|---|
| PubChem CID | 162980794 |
| Molecular Formula | C35H60O2 |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | [(4R)-4-[(3R,3aS,5aR,5bR,7aS,9R,11aS,11bR,13aR,13bS)-5a,5b,8,8,9,11a,13b-heptamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentyl] acetate |
| SMILES | CC(=O)OCCC[C@@H](C)[C@H]1CC[C@]2(C)[C@H]3CC[C@@H]4[C@@]5(C)CC[C@@H](C)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C35H60O2/c1-23(11-10-22-37-25(3)36)26-15-19-32(6)27(26)16-20-34(8)29(32)12-13-30-33(7)18-14-24(2)31(4,5)28(33)17-21-35(30,34)9/h23-24,26-30H,10-22H2,1-9H3/t23-,24-,26-,27+,28+,29-,30-,32+,33+,34-,35-/m1/s1 |
| InChIKey | FQWUCHINCULPHC-KCNRFGDESA-N |
| XLogP | 9.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|