C40H78 — CID 162940926
cis-(2R,3S)-1,1,3-trimethyl-2-[(3S,7R,12S,16S)-3,7,12,16-tetramethyl-18-[(1R,6S)-2,2,6-trimethylcyclohexyl]octadecyl]cyclohexane (PubChem CID 162940926) has the molecular formula C40H78 and a molecular weight of 559.06 g/mol. Its IUPAC name is cis-(2R,3S)-1,1,3-trimethyl-2-[(3S,7R,12S,16S)-3,7,12,16-tetramethyl-18-[(1R,6S)-2,2,6-trimethylcyclohexyl]octadecyl]cyclohexane.
| Compound Name | cis-(2R,3S)-1,1,3-trimethyl-2-[(3S,7R,12S,16S)-3,7,12,16-tetramethyl-18-[(1R,6S)-2,2,6-trimethylcyclohexyl]octadecyl]cyclohexane |
|---|---|
| PubChem CID | 162940926 |
| Molecular Formula | C40H78 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.61 |
| IUPAC Name | cis-(2R,3S)-1,1,3-trimethyl-2-[(3S,7R,12S,16S)-3,7,12,16-tetramethyl-18-[(1R,6S)-2,2,6-trimethylcyclohexyl]octadecyl]cyclohexane |
| SMILES | CC1CCCC(C)(C)[C@@H]1CC[C@@H](C)CCC[C@H](C)CCCC[C@H](C)CCC[C@H](C)CC[C@@H]1[C@@H](C)CCCC1(C)C |
| InChI | InChI=1S/C40H78/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h31-38H,11-30H2,1-10H3/t31-,32+,33-,34-,35-,36?,37+,38+/m0/s1 |
| InChIKey | KINNMTBWIQCDPS-DHHYUGMQSA-N |
| XLogP | 13.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|