C30H57N — CID 143786755
N-[7,12,12,15-tetramethyl-16-(2,2,6-trimethylcyclohexyl)hexadec-1-en-4-yl]methanimine (PubChem CID 143786755) has the molecular formula C30H57N and a molecular weight of 431.79 g/mol. Its IUPAC name is N-[7,12,12,15-tetramethyl-16-(2,2,6-trimethylcyclohexyl)hexadec-1-en-4-yl]methanimine.
| Compound Name | N-[7,12,12,15-tetramethyl-16-(2,2,6-trimethylcyclohexyl)hexadec-1-en-4-yl]methanimine |
|---|---|
| PubChem CID | 143786755 |
| Molecular Formula | C30H57N |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.45 |
| IUPAC Name | N-[7,12,12,15-tetramethyl-16-(2,2,6-trimethylcyclohexyl)hexadec-1-en-4-yl]methanimine |
| SMILES | C=CCC(CCC(C)CCCCC(C)(C)CCC(C)CC1C(C)CCCC1(C)C)N=C |
| InChI | InChI=1S/C30H57N/c1-10-14-27(31-9)18-17-24(2)15-11-12-20-29(5,6)22-19-25(3)23-28-26(4)16-13-21-30(28,7)8/h10,24-28H,1,9,11-23H2,2-8H3 |
| InChIKey | ZCIHAFWJOPFHEK-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|