C40H78O — CID 70877793
2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexyl)octadecyl]cyclohexan-1-ol (PubChem CID 70877793) has the molecular formula C40H78O and a molecular weight of 575.06 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexyl)octadecyl]cyclohexan-1-ol.
| Compound Name | 2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexyl)octadecyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 70877793 |
| Molecular Formula | C40H78O |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.61 |
| IUPAC Name | 2,4,4-trimethyl-3-[3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexyl)octadecyl]cyclohexan-1-ol |
| SMILES | CC(CCCCC(C)CCCC(C)CCC1C(C)C(O)CCC1(C)C)CCCC(C)CCC1C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H78O/c1-30(18-13-20-32(3)23-25-36-34(5)22-15-28-39(36,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-37-35(6)38(41)27-29-40(37,9)10/h30-38,41H,11-29H2,1-10H3 |
| InChIKey | JWCJRTXXUGKYQC-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|