C30H59NO4 — CID 139473549
3,7-dimethyl-N-[3-[2-(2-propoxyethoxy)ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide (PubChem CID 139473549) has the molecular formula C30H59NO4 and a molecular weight of 497.81 g/mol. Its IUPAC name is 3,7-dimethyl-N-[3-[2-(2-propoxyethoxy)ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide.
| Compound Name | 3,7-dimethyl-N-[3-[2-(2-propoxyethoxy)ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide |
|---|---|
| PubChem CID | 139473549 |
| Molecular Formula | C30H59NO4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.44 |
| IUPAC Name | 3,7-dimethyl-N-[3-[2-(2-propoxyethoxy)ethoxy]propyl]-9-(2,2,6-trimethylcyclohexyl)nonanamide |
| SMILES | CCCOCCOCCOCCCNC(=O)CC(C)CCCC(C)CCC1C(C)CCCC1(C)C |
| InChI | InChI=1S/C30H59NO4/c1-7-18-33-20-22-35-23-21-34-19-10-17-31-29(32)24-26(3)12-8-11-25(2)14-15-28-27(4)13-9-16-30(28,5)6/h25-28H,7-24H2,1-6H3,(H,31,32) |
| InChIKey | GCKCDGOCSVJGIO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|