C16H29NO — CID 144565970
2-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)acetamide (PubChem CID 144565970) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 2-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 144565970 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 2-(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)acetamide |
| SMILES | CC1CCC2C(C)(C)CCCC2(C)C1CC(N)=O |
| InChI | InChI=1S/C16H29NO/c1-11-6-7-13-15(2,3)8-5-9-16(13,4)12(11)10-14(17)18/h11-13H,5-10H2,1-4H3,(H2,17,18) |
| InChIKey | ZHSVGRLXTBTYHQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |