C25H38N2O4S — CID 123242081
5-[(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methylsulfonyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide (PubChem CID 123242081) has the molecular formula C25H38N2O4S and a molecular weight of 462.66 g/mol. Its IUPAC name is 5-[(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methylsulfonyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide.
| Compound Name | 5-[(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methylsulfonyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 123242081 |
| Molecular Formula | C25H38N2O4S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5-[(2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)methylsulfonyl]-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC)cc(S(=O)(=O)CC2C(C)CCC3C(C)(C)CCCC23C)c1 |
| InChI | InChI=1S/C25H38N2O4S/c1-16-8-9-21-24(2,3)10-7-11-25(21,4)20(16)15-32(30,31)19-13-17(22(28)26-5)12-18(14-19)23(29)27-6/h12-14,16,20-21H,7-11,15H2,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | OFVCSXLCCAQHCP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |