C23H36O4S — CID 144667521
1-[(3,5-dimethoxyphenyl)sulfonylmethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 144667521) has the molecular formula C23H36O4S and a molecular weight of 408.60 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)sulfonylmethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | 1-[(3,5-dimethoxyphenyl)sulfonylmethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 144667521 |
| Molecular Formula | C23H36O4S |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)sulfonylmethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | COc1cc(OC)cc(S(=O)(=O)CC2C(C)CCC3C(C)(C)CCCC23C)c1 |
| InChI | InChI=1S/C23H36O4S/c1-16-8-9-21-22(2,3)10-7-11-23(21,4)20(16)15-28(24,25)19-13-17(26-5)12-18(14-19)27-6/h12-14,16,20-21H,7-11,15H2,1-6H3 |
| InChIKey | MNENEEDHWRJUHH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |