C22H32O5S — CID 123887353
3-methoxy-5-[(2,5,5-trimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methylsulfonyl]benzoic acid (PubChem CID 123887353) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is 3-methoxy-5-[(2,5,5-trimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methylsulfonyl]benzoic acid.
| Compound Name | 3-methoxy-5-[(2,5,5-trimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 123887353 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-methoxy-5-[(2,5,5-trimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methylsulfonyl]benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(S(=O)(=O)CC2C(C)CCC3C2CCCC3(C)C)c1 |
| InChI | InChI=1S/C22H32O5S/c1-14-7-8-20-18(6-5-9-22(20,2)3)19(14)13-28(25,26)17-11-15(21(23)24)10-16(12-17)27-4/h10-12,14,18-20H,5-9,13H2,1-4H3,(H,23,24) |
| InChIKey | XMCIJUPNSKGEAA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |