C20H28O2 — CID 22297961
1-(3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-yl)ethanone (PubChem CID 22297961) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-(3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-yl)ethanone.
| Compound Name | 1-(3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-yl)ethanone |
|---|---|
| PubChem CID | 22297961 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1-(3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-1-yl)ethanone |
| SMILES | COc1cc(C(C)=O)c2c(c1)C1(C)CCCC(C)(C)C1CC2 |
| InChI | InChI=1S/C20H28O2/c1-13(21)16-11-14(22-5)12-17-15(16)7-8-18-19(2,3)9-6-10-20(17,18)4/h11-12,18H,6-10H2,1-5H3 |
| InChIKey | NLMORCPKRUQUIF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |