C44H62O4 — CID 162908373
[(4bS,8aS)-3-[(4bS,8aS)-2-acetyloxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl] acetate (PubChem CID 162908373) has the molecular formula C44H62O4 and a molecular weight of 654.98 g/mol. Its IUPAC name is [(4bS,8aS)-3-[(4bS,8aS)-2-acetyloxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl] acetate.
| Compound Name | [(4bS,8aS)-3-[(4bS,8aS)-2-acetyloxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 162908373 |
| Molecular Formula | C44H62O4 |
| Molecular Weight | 654.98 g/mol |
| Exact Mass | 654.46 |
| IUPAC Name | [(4bS,8aS)-3-[(4bS,8aS)-2-acetyloxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl] acetate |
| SMILES | CC(=O)Oc1c(-c2cc3c(c(C(C)C)c2OC(C)=O)CC[C@H]2C(C)(C)CCC[C@]32C)cc2c(c1C(C)C)CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C44H62O4/c1-25(2)37-29-15-17-35-41(7,8)19-13-21-43(35,11)33(29)23-31(39(37)47-27(5)45)32-24-34-30(38(26(3)4)40(32)48-28(6)46)16-18-36-42(9,10)20-14-22-44(34,36)12/h23-26,35-36H,13-22H2,1-12H3/t35-,36-,43+,44+/m0/s1 |
| InChIKey | UYSMQPXPZYWILX-RKLUENFDSA-N |
| XLogP | 11.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.98 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|