C24H32O5 — CID 11003905
[(4bS,8aS)-4-acetyloxy-4b,8,8-trimethyl-10-oxo-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-yl] acetate (PubChem CID 11003905) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(4bS,8aS)-4-acetyloxy-4b,8,8-trimethyl-10-oxo-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-yl] acetate.
| Compound Name | [(4bS,8aS)-4-acetyloxy-4b,8,8-trimethyl-10-oxo-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11003905 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(4bS,8aS)-4-acetyloxy-4b,8,8-trimethyl-10-oxo-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1c(C(C)C)cc2c(c1OC(C)=O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2=O |
| InChI | InChI=1S/C24H32O5/c1-13(2)16-11-17-18(27)12-19-23(5,6)9-8-10-24(19,7)20(17)22(29-15(4)26)21(16)28-14(3)25/h11,13,19H,8-10,12H2,1-7H3/t19-,24-/m0/s1 |
| InChIKey | QTCMLXZTFFQXQZ-CYFREDJKSA-N |
| XLogP | 5.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|