C24H32O6 — CID 59919882
(4aR)-6-acetyloxy-5-methoxycarbonyl-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid (PubChem CID 59919882) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (4aR)-6-acetyloxy-5-methoxycarbonyl-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid.
| Compound Name | (4aR)-6-acetyloxy-5-methoxycarbonyl-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
|---|---|
| PubChem CID | 59919882 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (4aR)-6-acetyloxy-5-methoxycarbonyl-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
| SMILES | COC(=O)c1c(OC(C)=O)c(C(C)C)cc2c1[C@@]1(C(=O)O)CCCC(C)(C)C1CC2 |
| InChI | InChI=1S/C24H32O6/c1-13(2)16-12-15-8-9-17-23(4,5)10-7-11-24(17,22(27)28)19(15)18(21(26)29-6)20(16)30-14(3)25/h12-13,17H,7-11H2,1-6H3,(H,27,28)/t17?,24-/m1/s1 |
| InChIKey | VPMWFTKHPTZITP-FZYLFJGDSA-N |
| XLogP | 4.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|