C25H38O6 — CID 163049871
2-[[(4bS,8aS)-4-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 163049871) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[[(4bS,8aS)-4-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[(4bS,8aS)-4-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163049871 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-[[(4bS,8aS)-4-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC(C)c1cc2c(c(O)c1OC1OCC(O)C(O)C1O)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C25H38O6/c1-13(2)15-11-14-7-8-17-24(3,4)9-6-10-25(17,5)18(14)20(28)22(15)31-23-21(29)19(27)16(26)12-30-23/h11,13,16-17,19,21,23,26-29H,6-10,12H2,1-5H3/t16?,17-,19?,21?,23?,25-/m0/s1 |
| InChIKey | HTEXSXCVDJMYMF-FBPIANFISA-N |
| XLogP | 3.36 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |