C26H38O4 — CID 177108058
[(4bS,8aS)-4b,8,8-trimethyl-4-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] propanoate (PubChem CID 177108058) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is [(4bS,8aS)-4b,8,8-trimethyl-4-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] propanoate.
| Compound Name | [(4bS,8aS)-4b,8,8-trimethyl-4-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] propanoate |
|---|---|
| PubChem CID | 177108058 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | [(4bS,8aS)-4b,8,8-trimethyl-4-propanoyloxy-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] propanoate |
| SMILES | CCC(=O)Oc1c(C(C)C)cc2c(c1OC(=O)CC)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C26H38O4/c1-8-20(27)29-23-18(16(3)4)15-17-11-12-19-25(5,6)13-10-14-26(19,7)22(17)24(23)30-21(28)9-2/h15-16,19H,8-14H2,1-7H3/t19-,26-/m0/s1 |
| InChIKey | ODRARVBHZMHISI-SIBVEZHUSA-N |
| XLogP | 6.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|