C26H40O6 — CID 21147812
(2R,3R,4S,5R,6R)-2-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 21147812) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 21147812 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)c1c(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)ccc2c1CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C26H40O6/c1-14(2)20-15-7-10-19-25(3,4)11-6-12-26(19,5)16(15)8-9-17(20)31-24-23(30)22(29)21(28)18(13-27)32-24/h8-9,14,18-19,21-24,27-30H,6-7,10-13H2,1-5H3/t18-,19+,21+,22+,23-,24+,26-/m1/s1 |
| InChIKey | FAHJLTDOPVFUOL-DSSISXNRSA-N |
| XLogP | 3.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |