C23H32O4 — CID 71770712
(3S,8S)-15-acetyl-3,14-dihydroxy-7,7-dimethyl-13-propan-2-yltricyclo[9.5.0.03,8]hexadeca-1(11),12,14-trien-16-one (PubChem CID 71770712) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (3S,8S)-15-acetyl-3,14-dihydroxy-7,7-dimethyl-13-propan-2-yltricyclo[9.5.0.03,8]hexadeca-1(11),12,14-trien-16-one.
| Compound Name | (3S,8S)-15-acetyl-3,14-dihydroxy-7,7-dimethyl-13-propan-2-yltricyclo[9.5.0.03,8]hexadeca-1(11),12,14-trien-16-one |
|---|---|
| PubChem CID | 71770712 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (3S,8S)-15-acetyl-3,14-dihydroxy-7,7-dimethyl-13-propan-2-yltricyclo[9.5.0.03,8]hexadeca-1(11),12,14-trien-16-one |
| SMILES | CC(=O)c1c(O)c(C(C)C)cc2c(c1=O)C[C@@]1(O)CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C23H32O4/c1-13(2)16-11-15-7-8-18-22(4,5)9-6-10-23(18,27)12-17(15)21(26)19(14(3)24)20(16)25/h11,13,18,25,27H,6-10,12H2,1-5H3/t18-,23-/m0/s1 |
| InChIKey | CZCNOWAZNPUCJO-MBSDFSHPSA-N |
| XLogP | 4.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |