C23H34O4 — CID 144667510
[(1S,3S,8aS)-3-(hydroxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dimethoxyphenyl)methanone (PubChem CID 144667510) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is [(1S,3S,8aS)-3-(hydroxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dimethoxyphenyl)methanone.
| Compound Name | [(1S,3S,8aS)-3-(hydroxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 144667510 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | [(1S,3S,8aS)-3-(hydroxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)[C@H]2C[C@@H](CO)CC3C(C)(C)CCC[C@@]32C)c1 |
| InChI | InChI=1S/C23H34O4/c1-22(2)7-6-8-23(3)19(9-15(14-24)10-20(22)23)21(25)16-11-17(26-4)13-18(12-16)27-5/h11-13,15,19-20,24H,6-10,14H2,1-5H3/t15-,19-,20?,23-/m1/s1 |
| InChIKey | ZBQCBJCBZRSXKJ-NBASKJDMSA-N |
| XLogP | 4.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |