C23H36O4 — CID 70676508
(1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenyl)-hydroxymethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 70676508) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenyl)-hydroxymethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenyl)-hydroxymethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 70676508 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenyl)-hydroxymethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | COc1cc(OC)cc(C(O)[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c1 |
| InChI | InChI=1S/C23H36O4/c1-21(2)9-7-10-22(3)18(21)8-11-23(4,25)20(22)19(24)15-12-16(26-5)14-17(13-15)27-6/h12-14,18-20,24-25H,7-11H2,1-6H3/t18-,19?,20+,22-,23+/m0/s1 |
| InChIKey | KDBULFZZDBNXOL-ZRTFFEJKSA-N |
| XLogP | 4.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |