C26H40O3S2 — CID 90290098
O-[2-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-1-(3,5-dimethoxyphenyl)ethyl] methylsulfanylmethanethioate (PubChem CID 90290098) has the molecular formula C26H40O3S2 and a molecular weight of 464.74 g/mol. Its IUPAC name is O-[2-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-1-(3,5-dimethoxyphenyl)ethyl] methylsulfanylmethanethioate.
| Compound Name | O-[2-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-1-(3,5-dimethoxyphenyl)ethyl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 90290098 |
| Molecular Formula | C26H40O3S2 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | O-[2-[(1S,2S,4aS,8aR)-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-1-(3,5-dimethoxyphenyl)ethyl] methylsulfanylmethanethioate |
| SMILES | COc1cc(OC)cc(C(C[C@H]2[C@@H](C)CC[C@H]3C(C)(C)CCC[C@]23C)OC(=S)SC)c1 |
| InChI | InChI=1S/C26H40O3S2/c1-17-9-10-23-25(2,3)11-8-12-26(23,4)21(17)16-22(29-24(30)31-7)18-13-19(27-5)15-20(14-18)28-6/h13-15,17,21-23H,8-12,16H2,1-7H3/t17-,21-,22?,23-,26+/m0/s1 |
| InChIKey | NRLJGLHWFPCVJK-CXYLOUTASA-N |
| XLogP | 7.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|