C24H38O2 — CID 123915245
1-[2-(3,5-dimethoxyphenyl)ethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 123915245) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenyl)ethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | 1-[2-(3,5-dimethoxyphenyl)ethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 123915245 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenyl)ethyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | COc1cc(CCC2C(C)CCC3C(C)(C)CCCC23C)cc(OC)c1 |
| InChI | InChI=1S/C24H38O2/c1-17-8-11-22-23(2,3)12-7-13-24(22,4)21(17)10-9-18-14-19(25-5)16-20(15-18)26-6/h14-17,21-22H,7-13H2,1-6H3 |
| InChIKey | OUFWMLXUXGDMAL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |