C23H36O3 — CID 141410333
(1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenoxy)methyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 141410333) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenoxy)methyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | (1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenoxy)methyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 141410333 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (1S,2R,4aS,8aS)-1-[(3,5-dimethoxyphenoxy)methyl]-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | COc1cc(OC)cc(OC[C@H]2[C@H](C)CC[C@H]3C(C)(C)CCC[C@]23C)c1 |
| InChI | InChI=1S/C23H36O3/c1-16-8-9-21-22(2,3)10-7-11-23(21,4)20(16)15-26-19-13-17(24-5)12-18(14-19)25-6/h12-14,16,20-21H,7-11,15H2,1-6H3/t16-,20+,21+,23-/m1/s1 |
| InChIKey | ZVSGNLZXCXGPLN-SBQCITLYSA-N |
| XLogP | 5.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |