C21H32O2 — CID 134875366
(1S,2S,4aS,8aS)-1-[hydroxy(phenyl)methyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 134875366) has the molecular formula C21H32O2 and a molecular weight of 316.48 g/mol. Its IUPAC name is (1S,2S,4aS,8aS)-1-[hydroxy(phenyl)methyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1S,2S,4aS,8aS)-1-[hydroxy(phenyl)methyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 134875366 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1S,2S,4aS,8aS)-1-[hydroxy(phenyl)methyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](C(O)c3ccccc3)[C@@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O2/c1-19(2)12-8-13-20(3)16(19)11-14-21(4,23)18(20)17(22)15-9-6-5-7-10-15/h5-7,9-10,16-18,22-23H,8,11-14H2,1-4H3/t16-,17?,18+,20-,21-/m0/s1 |
| InChIKey | MOAYDOZNWSVUFL-JAZZXYQNSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |