C30H50N2O3 — CID 100804777
(2S,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methyl-1-(4-phenylpiperazin-1-yl)pentane-2,3-diol (PubChem CID 100804777) has the molecular formula C30H50N2O3 and a molecular weight of 486.74 g/mol. Its IUPAC name is (2S,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methyl-1-(4-phenylpiperazin-1-yl)pentane-2,3-diol.
| Compound Name | (2S,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methyl-1-(4-phenylpiperazin-1-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 100804777 |
| Molecular Formula | C30H50N2O3 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.38 |
| IUPAC Name | (2S,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methyl-1-(4-phenylpiperazin-1-yl)pentane-2,3-diol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CC[C@@](C)(O)[C@@H](O)CN3CCN(c4ccccc4)CC3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C30H50N2O3/c1-27(2)14-9-15-28(3)24(27)12-16-29(4,34)25(28)13-17-30(5,35)26(33)22-31-18-20-32(21-19-31)23-10-7-6-8-11-23/h6-8,10-11,24-26,33-35H,9,12-22H2,1-5H3/t24-,25+,26-,28-,29+,30+/m0/s1 |
| InChIKey | YLEHMJUQHQEBPX-IIVFLOHNSA-N |
| XLogP | 4.69 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |