C16H30O3 — CID 11032939
1-[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethane-1,2-diol (PubChem CID 11032939) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethane-1,2-diol.
| Compound Name | 1-[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11032939 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-[(1S,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethane-1,2-diol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](C(O)CO)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C16H30O3/c1-14(2)7-5-8-15(3)12(14)6-9-16(4,19)13(15)11(18)10-17/h11-13,17-19H,5-10H2,1-4H3/t11?,12-,13+,15-,16+/m0/s1 |
| InChIKey | IPWXWGMCZKWSCU-INYYZSPWSA-N |
| XLogP | 2.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |