C24H38O4 — CID 59707434
(1R,2R,8aS)-1-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 59707434) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (1R,2R,8aS)-1-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,8aS)-1-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 59707434 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (1R,2R,8aS)-1-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | COc1ccc(C(O)C[C@@H]2[C@@]3(C)CCCC(C)(C)C3CC[C@@]2(C)O)cc1OC |
| InChI | InChI=1S/C24H38O4/c1-22(2)11-7-12-23(3)20(22)10-13-24(4,26)21(23)15-17(25)16-8-9-18(27-5)19(14-16)28-6/h8-9,14,17,20-21,25-26H,7,10-13,15H2,1-6H3/t17?,20?,21-,23+,24-/m1/s1 |
| InChIKey | OSKOVAZVRFZYOP-KLKMSBLHSA-N |
| XLogP | 5.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |