C31H41NO4 — CID 90280737
N-[(2R,3S,4S,4aS,8aS)-4-(3,5-dimethoxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]-3-methylbenzamide (PubChem CID 90280737) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is N-[(2R,3S,4S,4aS,8aS)-4-(3,5-dimethoxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]-3-methylbenzamide.
| Compound Name | N-[(2R,3S,4S,4aS,8aS)-4-(3,5-dimethoxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 90280737 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | N-[(2R,3S,4S,4aS,8aS)-4-(3,5-dimethoxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]-3-methylbenzamide |
| SMILES | COc1cc(OC)cc(C(=O)[C@H]2[C@H](C)[C@H](NC(=O)c3cccc(C)c3)C[C@H]3C(C)(C)CCC[C@]23C)c1 |
| InChI | InChI=1S/C31H41NO4/c1-19-10-8-11-21(14-19)29(34)32-25-18-26-30(3,4)12-9-13-31(26,5)27(20(25)2)28(33)22-15-23(35-6)17-24(16-22)36-7/h8,10-11,14-17,20,25-27H,9,12-13,18H2,1-7H3,(H,32,34)/t20-,25-,26+,27-,31+/m1/s1 |
| InChIKey | HNSXTGZXVKMRIC-HXEJGHFOSA-N |
| XLogP | 6.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |