C24H32N2O3 — CID 144667524
[(1S,3S,8aS)-3-(imidazol-1-ylmethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone (PubChem CID 144667524) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is [(1S,3S,8aS)-3-(imidazol-1-ylmethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone.
| Compound Name | [(1S,3S,8aS)-3-(imidazol-1-ylmethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 144667524 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [(1S,3S,8aS)-3-(imidazol-1-ylmethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone |
| SMILES | CC1(C)CCC[C@@]2(C)C1C[C@H](Cn1ccnc1)C[C@@H]2C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C24H32N2O3/c1-23(2)5-4-6-24(3)20(22(29)17-11-18(27)13-19(28)12-17)9-16(10-21(23)24)14-26-8-7-25-15-26/h7-8,11-13,15-16,20-21,27-28H,4-6,9-10,14H2,1-3H3/t16-,20-,21?,24-/m1/s1 |
| InChIKey | CAPKVPIWFCYYRA-DOZFBPCYSA-N |
| XLogP | 5.04 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |