C14H20N2O3 — CID 20530757
(1,2-diaminocyclopentyl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 20530757) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1,2-diaminocyclopentyl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (1,2-diaminocyclopentyl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 20530757 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1,2-diaminocyclopentyl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)C2(N)CCCC2N)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-18-10-6-9(7-11(8-10)19-2)13(17)14(16)5-3-4-12(14)15/h6-8,12H,3-5,15-16H2,1-2H3 |
| InChIKey | ZZDZSONZVIDOFB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |