C16H23NO3S — CID 79588025
methyl 1-amino-2-[2-(4-methoxyphenyl)sulfanylethyl]cyclopentane-1-carboxylate (PubChem CID 79588025) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is methyl 1-amino-2-[2-(4-methoxyphenyl)sulfanylethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-amino-2-[2-(4-methoxyphenyl)sulfanylethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79588025 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl 1-amino-2-[2-(4-methoxyphenyl)sulfanylethyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCC1CCSc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-19-13-5-7-14(8-6-13)21-11-9-12-4-3-10-16(12,17)15(18)20-2/h5-8,12H,3-4,9-11,17H2,1-2H3 |
| InChIKey | ZBMKPYJRFXZZNZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |