C13H19NO2S2 — CID 79587263
methyl 1-amino-2-(2-thiophen-2-ylsulfanylethyl)cyclopentane-1-carboxylate (PubChem CID 79587263) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is methyl 1-amino-2-(2-thiophen-2-ylsulfanylethyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-amino-2-(2-thiophen-2-ylsulfanylethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79587263 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | methyl 1-amino-2-(2-thiophen-2-ylsulfanylethyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCC1CCSc1cccs1 |
| InChI | InChI=1S/C13H19NO2S2/c1-16-12(15)13(14)7-2-4-10(13)6-9-18-11-5-3-8-17-11/h3,5,8,10H,2,4,6-7,9,14H2,1H3 |
| InChIKey | JJVRIHJZHSXNLP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |