C15H25NOS2 — CID 79581651
[1-(propan-2-ylamino)-2-(2-thiophen-2-ylsulfanylethyl)cyclopentyl]methanol (PubChem CID 79581651) has the molecular formula C15H25NOS2 and a molecular weight of 299.50 g/mol. Its IUPAC name is [1-(propan-2-ylamino)-2-(2-thiophen-2-ylsulfanylethyl)cyclopentyl]methanol.
| Compound Name | [1-(propan-2-ylamino)-2-(2-thiophen-2-ylsulfanylethyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 79581651 |
| Molecular Formula | C15H25NOS2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [1-(propan-2-ylamino)-2-(2-thiophen-2-ylsulfanylethyl)cyclopentyl]methanol |
| SMILES | CC(C)NC1(CO)CCCC1CCSc1cccs1 |
| InChI | InChI=1S/C15H25NOS2/c1-12(2)16-15(11-17)8-3-5-13(15)7-10-19-14-6-4-9-18-14/h4,6,9,12-13,16-17H,3,5,7-8,10-11H2,1-2H3 |
| InChIKey | HZGBRBGSVIGSOF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |