C14H23NOS2 — CID 79640772
[1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclohexyl]methanol (PubChem CID 79640772) has the molecular formula C14H23NOS2 and a molecular weight of 285.48 g/mol. Its IUPAC name is [1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclohexyl]methanol.
| Compound Name | [1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclohexyl]methanol |
|---|---|
| PubChem CID | 79640772 |
| Molecular Formula | C14H23NOS2 |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclohexyl]methanol |
| SMILES | CC(C)NC1(CO)CCCC(Sc2cccs2)C1 |
| InChI | InChI=1S/C14H23NOS2/c1-11(2)15-14(10-16)7-3-5-12(9-14)18-13-6-4-8-17-13/h4,6,8,11-12,15-16H,3,5,7,9-10H2,1-2H3 |
| InChIKey | KHPNQCNMCHLSMP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |