C13H20N2OS2 — CID 79653438
1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxamide (PubChem CID 79653438) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxamide.
| Compound Name | 1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79653438 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(propan-2-ylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxamide |
| SMILES | CC(C)NC1(C(N)=O)CCC(Sc2cccs2)C1 |
| InChI | InChI=1S/C13H20N2OS2/c1-9(2)15-13(12(14)16)6-5-10(8-13)18-11-4-3-7-17-11/h3-4,7,9-10,15H,5-6,8H2,1-2H3,(H2,14,16) |
| InChIKey | NKWUMLZRSQGJBC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |