C13H19NO2S2 — CID 79653828
1-(propylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxylic acid (PubChem CID 79653828) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-(propylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxylic acid.
| Compound Name | 1-(propylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79653828 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-(propylamino)-3-thiophen-2-ylsulfanylcyclopentane-1-carboxylic acid |
| SMILES | CCCNC1(C(=O)O)CCC(Sc2cccs2)C1 |
| InChI | InChI=1S/C13H19NO2S2/c1-2-7-14-13(12(15)16)6-5-10(9-13)18-11-4-3-8-17-11/h3-4,8,10,14H,2,5-7,9H2,1H3,(H,15,16) |
| InChIKey | XPSRBUBAQCOPPJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |