C15H23NO3S — CID 79637807
3-(furan-2-ylmethylsulfanyl)-1-(propylamino)cyclohexane-1-carboxylic acid (PubChem CID 79637807) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfanyl)-1-(propylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(furan-2-ylmethylsulfanyl)-1-(propylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79637807 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-(furan-2-ylmethylsulfanyl)-1-(propylamino)cyclohexane-1-carboxylic acid |
| SMILES | CCCNC1(C(=O)O)CCCC(SCc2ccco2)C1 |
| InChI | InChI=1S/C15H23NO3S/c1-2-8-16-15(14(17)18)7-3-6-13(10-15)20-11-12-5-4-9-19-12/h4-5,9,13,16H,2-3,6-8,10-11H2,1H3,(H,17,18) |
| InChIKey | QWLLRNBPSYWUSA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |