C17H31NO2S — CID 79633898
3-(3-methylcyclohexyl)sulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid (PubChem CID 79633898) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is 3-(3-methylcyclohexyl)sulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(3-methylcyclohexyl)sulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79633898 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 3-(3-methylcyclohexyl)sulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid |
| SMILES | CCCNC1(C(=O)O)CCCC(SC2CCCC(C)C2)C1 |
| InChI | InChI=1S/C17H31NO2S/c1-3-10-18-17(16(19)20)9-5-8-15(12-17)21-14-7-4-6-13(2)11-14/h13-15,18H,3-12H2,1-2H3,(H,19,20) |
| InChIKey | NJCWWNOVPXVXEZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |