C13H25NO2S — CID 79634817
3-propan-2-ylsulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid (PubChem CID 79634817) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 3-propan-2-ylsulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-propan-2-ylsulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79634817 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 3-propan-2-ylsulfanyl-1-(propylamino)cyclohexane-1-carboxylic acid |
| SMILES | CCCNC1(C(=O)O)CCCC(SC(C)C)C1 |
| InChI | InChI=1S/C13H25NO2S/c1-4-8-14-13(12(15)16)7-5-6-11(9-13)17-10(2)3/h10-11,14H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | ZJWAOXRCRYAZFH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |