C14H27NO3S — CID 79635019
3-(4-hydroxybutan-2-ylsulfanyl)-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid (PubChem CID 79635019) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is 3-(4-hydroxybutan-2-ylsulfanyl)-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(4-hydroxybutan-2-ylsulfanyl)-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79635019 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-(4-hydroxybutan-2-ylsulfanyl)-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)NC1(C(=O)O)CCCC(SC(C)CCO)C1 |
| InChI | InChI=1S/C14H27NO3S/c1-10(2)15-14(13(17)18)7-4-5-12(9-14)19-11(3)6-8-16/h10-12,15-16H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | RNLBCYOQIHNNMJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |