C16H22FNO2S — CID 79633596
3-(2-fluorophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid (PubChem CID 79633596) has the molecular formula C16H22FNO2S and a molecular weight of 311.42 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79633596 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-1-(propan-2-ylamino)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)NC1(C(=O)O)CCCC(Sc2ccccc2F)C1 |
| InChI | InChI=1S/C16H22FNO2S/c1-11(2)18-16(15(19)20)9-5-6-12(10-16)21-14-8-4-3-7-13(14)17/h3-4,7-8,11-12,18H,5-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | PVVWAYJLEJOPBE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |