C13H19N3O3S — CID 79653898
3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-1-(propan-2-ylamino)cyclopentane-1-carboxylic acid (PubChem CID 79653898) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-1-(propan-2-ylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-1-(propan-2-ylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79653898 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-1-(propan-2-ylamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(C)NC1(C(=O)O)CCC(Sc2nccc(=O)[nH]2)C1 |
| InChI | InChI=1S/C13H19N3O3S/c1-8(2)16-13(11(18)19)5-3-9(7-13)20-12-14-6-4-10(17)15-12/h4,6,8-9,16H,3,5,7H2,1-2H3,(H,18,19)(H,14,15,17) |
| InChIKey | MZNQXIUEJXCMCZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |