C15H28N2OS — CID 79653484
1-(ethylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxamide (PubChem CID 79653484) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 1-(ethylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxamide.
| Compound Name | 1-(ethylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79653484 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-(ethylamino)-3-(3-methylcyclohexyl)sulfanylcyclopentane-1-carboxamide |
| SMILES | CCNC1(C(N)=O)CCC(SC2CCCC(C)C2)C1 |
| InChI | InChI=1S/C15H28N2OS/c1-3-17-15(14(16)18)8-7-13(10-15)19-12-6-4-5-11(2)9-12/h11-13,17H,3-10H2,1-2H3,(H2,16,18) |
| InChIKey | DQNFSEJAKQXYTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |