C12H24N2O3S2 — CID 79634497
1-(ethylamino)-3-(2-methylsulfonylethylsulfanyl)cyclohexane-1-carboxamide (PubChem CID 79634497) has the molecular formula C12H24N2O3S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-(ethylamino)-3-(2-methylsulfonylethylsulfanyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(ethylamino)-3-(2-methylsulfonylethylsulfanyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79634497 |
| Molecular Formula | C12H24N2O3S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-(ethylamino)-3-(2-methylsulfonylethylsulfanyl)cyclohexane-1-carboxamide |
| SMILES | CCNC1(C(N)=O)CCCC(SCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H24N2O3S2/c1-3-14-12(11(13)15)6-4-5-10(9-12)18-7-8-19(2,16)17/h10,14H,3-9H2,1-2H3,(H2,13,15) |
| InChIKey | MEEIHSJWOOPDMC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |