C13H24N2O3S — CID 114234386
1-(ethylamino)-3-[2-(ethylamino)-2-oxoethyl]sulfanylcyclohexane-1-carboxylic acid (PubChem CID 114234386) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-(ethylamino)-3-[2-(ethylamino)-2-oxoethyl]sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(ethylamino)-3-[2-(ethylamino)-2-oxoethyl]sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114234386 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-(ethylamino)-3-[2-(ethylamino)-2-oxoethyl]sulfanylcyclohexane-1-carboxylic acid |
| SMILES | CCNC(=O)CSC1CCCC(NCC)(C(=O)O)C1 |
| InChI | InChI=1S/C13H24N2O3S/c1-3-14-11(16)9-19-10-6-5-7-13(8-10,12(17)18)15-4-2/h10,15H,3-9H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | OLYYRSJSPZOIJE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |