C13H21N3O2S — CID 79634039
1-(ethylamino)-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxylic acid (PubChem CID 79634039) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(ethylamino)-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(ethylamino)-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79634039 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(ethylamino)-3-(1-methylpyrazol-4-yl)sulfanylcyclohexane-1-carboxylic acid |
| SMILES | CCNC1(C(=O)O)CCCC(Sc2cnn(C)c2)C1 |
| InChI | InChI=1S/C13H21N3O2S/c1-3-14-13(12(17)18)6-4-5-10(7-13)19-11-8-15-16(2)9-11/h8-10,14H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | NUXMWCLQKDNQGX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |